Details of SAPdb entry with Sequence Cha–F |
| Primary information | |
|---|---|
| SAPdb ID | 1544, |
| PMID | 21221462 |
| Peptide Name | Cha–Phe (Cyclohexylalanine- Phenylalanine) |
| Peptide sequence | Cha–F |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | Cha=Cyclohexylalanine |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) and DLS (Dynamic Light scattering) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water |
| Method | 1mg of a purified peptide in 50 ml of HFIP and by subsequent addition of 1 ml of double distilled water. Samples were aged for 2– 24 hours. |
| Conc | 1 mg/ml |
| Temperature | Room temperature |
| Incubation Time | 2 -24 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Vesicular and fibrillar assemblies |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable < 55°C; stable under wide range of pH | |
| Nanovesicle, Nanofibers | |
| 50 | |
| AF | |
| N[C@@H](CC1CCCCC1)C(=O)N[C@@H](Cc1ccccc1)C=O | |