Details of SAPdb entry with Sequence FK |
| Primary information | |
|---|---|
| SAPdb ID | 1343, |
| PMID | 23884374 |
| Peptide Name | Cyclo(L-Phe-Lys) or Dipeptide 6 |
| Peptide sequence | FK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Phosphate buffer (pH 6) |
| Conc | 2% w/v |
| Temperature | pH 8 - 11 |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Hydrogel gel (Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| Stable at high temperature | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1430, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Mesitylene |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 30 seconds. Finally gel formation occur at room temperature. |
| Conc | 0.6% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1431, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pentane |
| Method | Gelator dissolved solvent and heated to 70 °C followed by Sonication. Finally gel formation occur at room temperature. |
| Conc | 4% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Opaque Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1432, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Hexane |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 10 seconds. Finally gel formation occur at room temperature. |
| Conc | 4% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Opaque Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1433, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Heptane |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 10 seconds. Finally gel formation occur at room temperature. |
| Conc | 3.79% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Opaque Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1434, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Octane |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 10 seconds. Finally gel formation occur at room temperature. |
| Conc | 3.69% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Opaque Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1435, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Decane |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 5 seconds. Finally gel formation occur at room temperature. |
| Conc | 0.73% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1436, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | m-Xylene |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 50 seconds. Finally gel formation occur at room temperature. |
| Conc | 0.6% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1437, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | p-Xylene |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 30 seconds. Finally gel formation occur at room temperature. |
| Conc | 1.2% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1438, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | o-Xylene |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 30 seconds. Finally gel formation occur at room temperature. |
| Conc | 1.2% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1439, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Toluene |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 50 seconds. Finally gel formation occur at room temperature. |
| Conc | 1.2% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1440, |
| PMID | 23255295 |
| Peptide Name | Dipeptide 1 or Boc-L-Phe-L-Lys(Z)-OMe |
| Peptide sequence | FK |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Cyclohexane |
| Method | Gelator dissolved solvent and heated to 70 °C. Sonicated for 50 seconds. Finally gel formation occur at room temperature. |
| Conc | 0.55% wt |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable | |
| Hydrogel | |
| NA | |
| FK | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1632, |
| PMID | 23795243 |
| Peptide Name | FK |
| Peptide sequence | FK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Insilico method: MARTINI coarse - grained molecular dynamic |
| Solvent | Water |
| Method | A simulation for each dipeptide (in their zwitterionic form) was set up using the GROMACS molecular dynamics package. A cubic box with 300 dipeptides, placed randomly with a minimum distance of 3 Å between them, was solvated in standard MARTINI CG water (four water molecules per bead) to a final concentration of ∼0.4 M. A Berendsen thermostat and barostat36 were used to keep the temperature at 303 K and pressure at 1 bar, respectively. Bond lengths in aromatic side chains and the backbone side-chain bonds in I, V, and Y were constrained using the LINCS algorithm.37 All boxes were energy minimized using the steepest descent integrator and then equilibrated for 4 106 time steps of 25 fs. The total screening simulation time equates to 100 ns, but because of the smoothness of the CG potentials, this roughly equates to an effective 400 ns of atomistic simulation time |
| Conc | 0.4M |
| Temperature | 30°C |
| Year | 2011 |
| Self assembly | No |
| Type of Self assembly | None |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FK | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCC[NH3])C=O | |