Details of SAPdb entry with Sequence GF |
| Primary information | |
|---|---|
| SAPdb ID | 1272, |
| PMID | 19705843 |
| Peptide Name | Fmoc-GF |
| Peptide sequence | GF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide first dissolved in DMSO and then diluted in water to their final concentration 5mg/ml. Self assembled structure formed at room temperature |
| Conc | 5mg/ml |
| Temperature | |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Microtube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 3000 | |
| GF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1409, |
| PMID | 25229206 |
| Peptide Name | NDI-Gly-Phe or 3 |
| Peptide sequence | GF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 4.3 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| GF | |
| NCC(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1413, |
| PMID | 25229206 |
| Peptide Name | NDI-Gly-Phe or 3 |
| Peptide sequence | GF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 7.4 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| None | |
| NA | |
| GF | |
| NCC(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1577, |
| PMID | 21995651 |
| Peptide Name | FmocGF |
| Peptide sequence | GF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + Sodium hydroxide + HCl |
| Method | Fmocdipeptide was suspended in water. Sodium hydroxide (0.5 M) was gradually added to the aqueous suspensions of Fmoc dipeptide until pH 10.5 was reached. The samples were vortexed and sonicated for 1 min to fully dissolve the short peptide amphiphiles. 0.085 M HCl added dropwise to attain desired pH, followed by vortexing and sonication. Sample heated to 75-80 °C fto dissolve the peptide.. The sample was subsequently cooled and maintained at 4 °C for∼12 h (overnight) to promote or maintain gelation. |
| Conc | 1- 20 mmlol/L |
| Temperature | 10.5 |
| Temperature | Intial boiling to 75 -80°C heating for 2 minutes and followed by cooling at 4°C |
| Incubation Time | 12 hours |
| Year | 2011 |
| Self assembly | No |
| Type of Self assembly | No hydrogel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| GF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1578, |
| PMID | 21995651 |
| Peptide Name | FmocGF |
| Peptide sequence | GF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + Sodium hydroxide + HCl |
| Method | Fmocdipeptide was suspended in water. Sodium hydroxide (0.5 M) was gradually added to the aqueous suspensions of Fmoc dipeptide until pH 10.5 was reached. The samples were vortexed and sonicated for 1 min to fully dissolve the short peptide amphiphiles. 0.085 M HCl added dropwise to attain desired pH, followed by vortexing and sonication. Sample heated to 75-80 °C fto dissolve the peptide.. The sample was subsequently cooled and maintained at 4 °C for∼12 h (overnight) to promote or maintain gelation. |
| Conc | 1- 20 mmlol/L |
| Temperature | 4.4 - 7.3 |
| Temperature | Intial boiling to 75 -80°C heating for 2 minutes and followed by cooling at 4°C |
| Incubation Time | 12 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Sheet like structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 200 | |
| GF | |
| N.A. | |