Details of SAPdb entry with Sequence IVD |
| Primary information | |
|---|---|
| SAPdb ID | 1160, |
| PMID | 21205900 |
| Peptide Name | Ac-IVD |
| Peptide sequence | IVD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. |
| Conc | 15 - 20mg/ml |
| Temperature | Room temperature |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel consists of fibrillar structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable under physiological conditions | |
| Hydrogel | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O | |
| Primary information | |
| SAPdb ID | 1161, |
| PMID | 22016623 |
| Peptide Name | Ac-ID3 |
| Peptide sequence | IVD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Membrane structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Others | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O | |
| Primary information | |
| SAPdb ID | 1162, |
| PMID | 22016623 |
| Peptide Name | Ac-ID3 |
| Peptide sequence | IVD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hollow Nanosphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Nanosphere | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O | |
| Primary information | |
| SAPdb ID | 1163, |
| PMID | 22016623 |
| Peptide Name | Ac-ID3 |
| Peptide sequence | IVD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. |
| Conc | 14mg/ml |
| Temperature | Room temperature |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O | |
| Primary information | |
| SAPdb ID | 1168, |
| PMID | 23267112 |
| Peptide Name | Ac-ID3 |
| Peptide sequence | IVD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Hyrogel prepared by ring cast method |
| Conc | 12mM |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| None | |
| CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O | |