Details of SAPdb entry with Sequence IYF |
| Primary information | |
|---|---|
| SAPdb ID | 1140, |
| PMID | 25515887 |
| Peptide Name | IYF |
| Peptide sequence | IYF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and FTIR (Fourier Transform Infrared) |
| Solvent | water |
| Method | Tripeptides were dissolved in water by sonication and vortexing, followed by bringing the pH to 7.2 ± 0.1 by dropwise addition of 0.25 M NaOH solution to a final concentration of 30 mmol l!1.Characterization of the resulting samples took place at least 24 h after sample preparation |
| Conc | 30mMol/L |
| Temperature | pH 7 |
| Temperature | 25C |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | Precipitation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| None | |
| N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |