Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence KKK |
| Primary information | |
|---|---|
| SAPdb ID | 1180, |
| PMID | 22543454 |
| Peptide Name | Tripeptide 1 |
| Peptide sequence | KKK |
| N-Terminal Modification | Fmoc(fluorenyl-9-methoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | A drop of aqueous solution (0.01 %) of eptide was placed on a carbon-coated copper grid and allowing the solution to evaporate under ambient conditions. |
| Conc | 200 μM |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 6.7 | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1181, |
| PMID | 22543454 |
| Peptide Name | Tripeptide 2 |
| Peptide sequence | KKK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | A drop of aqueous solution (0.01 %) of eptide was placed on a carbon-coated copper grid and allowing the solution to evaporate under ambient conditions. |
| Conc | 200 μM |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Twisted Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 19 | |
| None | |
| CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O | |
| Primary information | |
| SAPdb ID | 1182, |
| PMID | 22543454 |
| Peptide Name | Tripeptide 3 |
| Peptide sequence | KKK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | A drop of aqueous solution (0.01 %) of eptide was placed on a carbon-coated copper grid and allowing the solution to evaporate under ambient conditions. |
| Conc | 200 μM |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Nanosphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanosphere | |
| 40 | |
| None | |
| N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O | |