Details of SAPdb entry with Sequence VIE |
| Primary information | |
|---|---|
| SAPdb ID | 1130, |
| PMID | 25010703 |
| Peptide Name | Ac-VIE |
| Peptide sequence | VIE |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | water |
| Method | The peptides were dissolved by vortexing in deionized water. For proper self-asSEM (Scanning Electron Microscopy)bly, all The tripeptide sampleskept for 24 hours |
| Conc | 5-10mg/ml |
| Temperature | 22°C |
| Incubation Time | 48hours and 10 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel consist of fibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 30 | |
| None | |
| CC(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(=O)O)C=O | |