Details of SAPdb entry with Sequence VYK |
| Primary information | |
|---|---|
| SAPdb ID | 1119, |
| PMID | 16339876 |
| Peptide Name | Ac-VYK |
| Peptide sequence | VYK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | 5 mM or 20 mM 3-[N-morpholino]- propanesulfonic acid (MOPS) buffer, |
| Method | Peptide was dissolved in either 5 mM or 20 mM 3-[N-morpholino]-propanesulfonic acid (MOPS) buffer, pH 7.2 The final concentration of the peptide was 0.1 -1 mg/mL. Sample was aged at least two days at room temperature ( approximately at 21°C) |
| Conc | 0.1-1mg/ml |
| Temperature | pH 7.2 |
| Temperature | Approximately at 21°C |
| Incubation Time | 2 days |
| Year | 2006 |
| Self assembly | Yes |
| Type of Self assembly | Tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 5 | |
| None | |
| CC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCC[NH3])C=O | |