Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence YFK |
| Primary information | |
|---|---|
| SAPdb ID | 1072, |
| PMID | 23871602 |
| Peptide Name | YFK |
| Peptide sequence | YFK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy), TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and CD (Circular Dichroism spectroscopy) |
| Solvent | Water and HFIP (9.5:0.5, v/v) |
| Method | For preparation of FFK solution, the mixture of water and HFIP (9.5:0.5, v/v) was used to dissolve the peptide at 5 mg/mL with sonication for 30 min. final solution pH was around 5–6. The peptide solutions were incubated for at least one week |
| Conc | 5mg/ml |
| Temperature | pH 5-6 |
| Incubation Time | 2 weeks |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Parallel aligned fibrils |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 4.2 | |
| None | |
| CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCC[NH3])C(=O)N | |