Details of SAPdb ID 1013 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1013 | |
| PMID | 12714741 | |
| Year | 2003 | |
| Name | NH2-L-Phe-L-Phe-COOH | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM (Transmission Electron Microscopy) | |
| Solvent | Aqueous dispersion | |
| Method | NH2-L-Phe-L-Phe-COOH dipeptide solublized at very high concentrations ( >=100 mg/ml) by dissolving the lyophilized peptide in 1,1,1,3,3,3 hexafluoro-2-propanol. The peptide appeared to be highly soluble in the organic solvent, a rapid assembly into ordered semicrystalline structures was observed visually within seconds after dilution into the aqueous solution at a final µM concentration range. | |
| Concentration | >=100 mg/ml stock soln | |
| pH | NA | |
| Temperature | 80°C | |
| Incubation Period | Within few minutes | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotube | |
| Size of Self-Assembled structure | Nanotube diameter varied from 50-250nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | After 1 hour of incubation of the Phe-Phe peptide with proteinase K (0.02 mg/ml), no tubular structures were observed by electron microscopy examination (as compared with hundreds of tubular structures observed before the proteolysis). | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |