| Primary information |
|---|
| SAPdb_ID | 1015 |
| PMID | 16430299 |
| Year | 2006 |
| Name | Diphenylalanine peptide |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol at a concentration of 100 mg/mL. Peptide stock solution was diluted in double distilled (dd) H2O to a final concentration of 2 mg/mL incubated in a water bath at 80 °C for 1 h. |
| Concentration | 2 mg/ml |
| pH | NA |
Temperature
| Stable upto 90°C |
| Incubation Period | Within few minutes |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotube |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | In addition to thermal stability, the peptide nanotubes were chemically stable in organic solvents |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
