Details of SAPdb ID 1017 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1017 | |
| PMID | 17172307 | |
| Year | 2007 | |
| Name | NH2-Ile-Phe-COOH | |
| Sequence | IF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) | |
| Solvent | Aqueous dispersion | |
| Method | Dipeptide samples were diluted in 1,1,1,3,3,3 hexafluoro-2-propanol to obtain stocks of 100 mg/ml and 200 mg/ml, which were further diluted in water | |
| Concentration | 2% (w/v) | |
| pH | pH 5.8 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanofibrils | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](Cc1ccccc1)C=O | |