| Primary information |
|---|
| SAPdb_ID | 1017 |
| PMID | 17172307 |
| Year | 2007 |
| Name | NH2-Ile-Phe-COOH |
| Sequence | IF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Dipeptide samples were diluted in 1,1,1,3,3,3 hexafluoro-2-propanol to obtain stocks of 100 mg/ml and 200 mg/ml, which were further diluted in water |
| Concentration | 2% (w/v) |
| pH | pH 5.8 |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanofibrils |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](Cc1ccccc1)C=O |
