Details of SAPdb ID 1066 |
Primary information | ||
---|---|---|
SAPdb_ID | 1066 | |
PMID | 23422591 | |
Year | 2013 | |
Name | D-leu-Phe-Phe | |
Sequence | lFF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Cryo - TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), CD (Circular Dichroism spectroscopy), FTIR (Fourier Transform Infrared) | |
Solvent | Sodium phosphate(0.1M, pH-11.8 and pH5.7) | |
Method | Peptide (4.0 mg) was added to a solution of sodium phosphate 0.1 M at pH 11.8 (buffer A, 0.3 ml), and dissolution was achieved with sonication (5 min). Gelation was triggered by subsequent addition of an equal volume of 0.1 M sodium phosphate at pH 5.7 (buffer B, 0.3 ml), resulting in a final pH of 7.4. | |
Concentration | 4mg/ml | |
pH | Final pH - 7.4 | |
Temperature | 37°C | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogel | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | 2 - 3 hours | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO |