Details of SAPdb ID 1067 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1067 | |
| PMID | 23598886 | |
| Year | 2013 | |
| Name | (L-Lys)-(L-Phe)-(L-Ala) | |
| Sequence | KFA | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Conjugate | |
| Conjugate Partner | perylene diimide (PDI) | |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy), FTIR (Fourier Transform Infrared) Spectroscopy (Fourier Transform Infrared) Spectroscopy and CD (Circular Dichroism spectroscopy) | |
| Solvent | THF(< 10uM) | |
| Method | Peptide is soluble in tetrahydrofuran (THF) it becomes partially soluble. Upon heating a peptide solution at concentration 10x10-4 M to 60 °C for several minutes and then this solution was sonicated (0.40 W cm2 and 40 KHz) for 30–60 min and then kept to 3–5 °C in the refrigerator for 2 days, self-assembled structure formed. | |
| Concentration | > 1.0x 10-5 M | |
| pH | NA | |
| Temperature | 3-5°C | |
| Incubation Period | 2 days | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Left handed Nanohelicals structure | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C=O | |