| Primary information |
|---|
| SAPdb_ID | 1069 |
| PMID | 23598886 |
| Year | 2013 |
| Name | (L-Lys)-(L-Phe)-(L-Ala) |
| Sequence | KFA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | perylene diimide (PDI) |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy), FTIR (Fourier Transform Infrared) Spectroscopy (Fourier Transform Infrared) Spectroscopy and CD (Circular Dichroism spectroscopy) |
| Solvent | THF(< 10uM) |
| Method | Peptide is soluble in tetrahydrofuran (THF) it becomes partially soluble. Upon heating a peptide solution at concentration 10x10-4 M to 60 °C for several minutes and then cooling to 3–5 °C in the refrigerator for 2 days, self-assembled structure formed. |
| Concentration | > 2.0x 10-5 M |
| pH | NA |
Temperature
| 3-5°C |
| Incubation Period | 2 days |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanoparticle |
| Size of Self-Assembled structure | Size: 5nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C=O |
