| Primary information |
|---|
| SAPdb_ID | 1073 |
| PMID | 23871602 |
| Year | 2013 |
| Name | YYK |
| Sequence | YYK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | AFM (Atomic Force Microscopy), TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and CD (Circular Dichroism spectroscopy) |
| Solvent | Water and HFIP (9.5:0.5, v/v) |
| Method | For preparation of FFK solution, the mixture of water and HFIP (9.5:0.5, v/v) was used to dissolve the peptide at 5 mg/mL with sonication for 30 min. final solution pH was around 5–6. The peptide solutions were incubated for at least one week |
| Concentration | 5mg/ml |
| pH | pH 5-6 |
Temperature
| NA |
| Incubation Period | 2 weeks |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Spherical aggregates |
| Size of Self-Assembled structure | 15-25nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCC[NH3])C(=O)N |
