| Primary information |
|---|
| SAPdb_ID | 1076 |
| PMID | 22159641 |
| Year | 2012 |
| Name | VFF |
| Sequence | VFF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), CD (Circular Dichroism spectroscopy) and FTIR (Fourier Transform Infrared) Spectroscopy (Fourier Transform Infrared) Spectroscopy |
| Solvent | 0.1M Phosphate buffer |
| Method | Peptide wast dissolved in a 0.1 M sodium phosphate solution at pH 12, while subsequent dilution to final physiological pH at 7.4 triigered the formation of hydrogel at room temperature within 24 hours. |
| Concentration | NA |
| pH | pH 7.4 |
Temperature
| NA |
| Incubation Period | NA |
| Self-Assembly Formation | No |
| Type of Self-Assembly | No self assembled structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
