| Primary information |
|---|
| SAPdb_ID | 1078 |
| PMID | 24338837 |
| Year | 2014 |
| Name | KFG |
| Sequence | KFG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. |
| Concentration | 0.5mg/ml |
| pH | pH 7.4 |
Temperature
| 20°C-70°C |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Vesicular Nanostructure |
| Size of Self-Assembled structure | 50 +/- 70nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable at pH 7.4, unstable at 90°C |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O |
