Details of SAPdb ID 1079 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1079 | |
| PMID | 24338837 | |
| Year | 2014 | |
| Name | KFG | |
| Sequence | KFG | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and AFM (Atomic Force Microscopy) | |
| Solvent | Water | |
| Method | Peptide dispersed in PBS 1X buffer (pH 7.4) in an autoclaved with brief sonication. This suspension was kept at 4 ºC. | |
| Concentration | 5mg/ml | |
| pH | pH 7.4 | |
| Temperature | 20°C-70°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotube structure | |
| Size of Self-Assembled structure | Diameter: 190 -/+10 nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable at 90°C | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC=O | |