Details of SAPdb ID 1100 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1100 | |
| PMID | 26014441 | |
| Year | 2015 | |
| Name | Peptide 2a | |
| Sequence | DFF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM (Transmission Electron Microscopy), FTIR and DOSY NMR | |
| Solvent | Sodium phosphate buffer (100mM ) | |
| Method | 20 mM of aspartame (DF-OMe) and 40 mM of the amino acid amide (Phe-NH2) were dissolved in 1 ml of 100mM sodium phosphate buffer pH 8 in the presence of 1 mg of chymotrypsin. The mixture was gently vortexed for 30s and sonicated for 60s in order to obtain a homogenous solution. gealtion was observed. | |
| Concentration | NA | |
| pH | 8 | |
| Temperature | NA | |
| Incubation Period | 8 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Spherical Nano structures | |
| Size of Self-Assembled structure | Length :1-2 μm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N | |