| Primary information |
|---|
| SAPdb_ID | 1101 |
| PMID | 26014441 |
| Year | 2015 |
| Name | Peptide 2b |
| Sequence | DFY |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), FTIR and DOSY NMR |
| Solvent | Sodium phosphate buffer (100mM ) |
| Method | 20 mM of aspartame (DF-OMe) and 40 mM of the amino acid amide (Tyr-NH2) were dissolved in 1 ml of 100mM sodium phosphate buffer pH 8 in the presence of 1 mg of chymotrypsin. The mixture was gently vortexed for 30s and sonicated for 60s in order to obtain a homogenous solution. gealtion was observed. |
| Concentration | NA |
| pH | 8 |
Temperature
| NA |
| Incubation Period | 24 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Spherical Nano structures |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N |
