Welcome to Entry Card of Peptide
Details of SAPdb ID 1102 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1102 | |
| PMID | 25891849 | |
| Year | 2012 | |
| Name | D-phenylalanine-L-phenylalanine-L-aspartic acid | |
| Sequence | fFD | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) | |
| Solvent | Methanol (25 mM) | |
| Method | 10 mg of peptide was fully dissolved in 1 ml methanol (25 mM) by heating up to 50°C for 3 minutes. Gel formed on cooling down to room temperature. | |
| Concentration | 10mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Disorder Short fibres | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C=O | |