| Primary information |
|---|
| SAPdb_ID | 1102 |
| PMID | 25891849 |
| Year | 2012 |
| Name | D-phenylalanine-L-phenylalanine-L-aspartic acid |
| Sequence | fFD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) |
| Solvent | Methanol (25 mM) |
| Method | 10 mg of peptide was fully dissolved in 1 ml methanol (25 mM) by heating up to 50°C for 3 minutes. Gel formed on cooling down to room temperature. |
| Concentration | 10mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Disorder Short fibres |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C=O |
