Details of SAPdb ID 1105 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1105 | |
| PMID | 25891849 | |
| Year | 2012 | |
| Name | D- phenylalanine-L-phenylalanine-L-isoleucine | |
| Sequence | fDI | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and CD (Circular Dichroism spectroscopy) | |
| Solvent | Phosphate buffer (30mM,) | |
| Method | 12.5 mg of peptide was dissolved in 1 ml phosphate buffer solution (pH 8) (30 mM). The solubility was enhanced by heating up to 80 °C. Sample was given ultrasonic treatment for 60 seconds and gel formed. | |
| Concentration | 12.5mg/ml | |
| pH | pH8 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogel consists of highly ordred fibers | |
| Size of Self-Assembled structure | Thickness:1 μm, and length :100 μm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | With ultrasonic waves treatment | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C=O | |