| Primary information |
|---|
| SAPdb_ID | 1116 |
| PMID | 11457225 |
| Year | 2001 |
| Name | Glutathione |
| Sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | 90% DMF + 10% water |
| Method | Solutions prepared by adding DMF to aqueous GSSG solutions produce gels within minutes at concentrations as low as 5 mM (3 mg/mL) in 90% DMF. |
| Concentration | 3mg/ml or 5mM |
| pH | NA |
Temperature
| 65°C |
| Incubation Period | few minutes |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Gel consists of fibril structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable at room temperature for months; Unstable above 50°C |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O |
