| Primary information |
|---|
| SAPdb_ID | 1117 |
| PMID | 11457225 |
| Year | 2001 |
| Name | Glutathione |
| Sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) and NMR |
| Solvent | 90% Methanol + 10%water |
| Method | Solutions prepared by adding methanol to aqueous GSSG solutions require cooling to about 0 °C to produce transparent gels |
| Concentration | 0.9mg/ml or 1.5mM |
| pH | NA |
Temperature
| 0°C |
| Incubation Period | 1 week |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Gel consists of fibril structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable at room temperature for months; Unstable above 50°C |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O |
