| Primary information |
|---|
| SAPdb_ID | 1118 |
| PMID | 16029045 |
| Year | 2005 |
| Name | Glutathione |
| Sequence | ECG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | Conjugated with pyrene |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and CD (Circular Dichroism spectroscopy) |
| Solvent | 95%water+ 5% DMSO |
| Method | Addition of water to peptide-conjuagate stock solution in DMSO in ratio (5:95) at final conc 1-10mM. It immediately generate transparent and flourescent gel. |
| Concentration | 10mM |
| pH | NA |
Temperature
| NA |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Transparent gel |
| Size of Self-Assembled structure | Diameter: 50-100nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O |
