Welcome to Entry Card of Peptide
Details of SAPdb ID 1118 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1118 | |
| PMID | 16029045 | |
| Year | 2005 | |
| Name | Glutathione | |
| Sequence | ECG | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Conjugate | |
| Conjugate Partner | Conjugated with pyrene | |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and CD (Circular Dichroism spectroscopy) | |
| Solvent | 95%water+ 5% DMSO | |
| Method | Addition of water to peptide-conjuagate stock solution in DMSO in ratio (5:95) at final conc 1-10mM. It immediately generate transparent and flourescent gel. | |
| Concentration | 10mM | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Transparent gel | |
| Size of Self-Assembled structure | Diameter: 50-100nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O | |