| Primary information |
|---|
| SAPdb_ID | 1126 |
| PMID | 25010703 |
| Year | 2014 |
| Name | Ac-YYD |
| Sequence | YYD |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | water |
| Method | The peptides were dissolved by vortexing in deionized water. For proper self-asSEM (Scanning Electron Microscopy)bly, all The tripeptide samples kept for 24-48 hours |
| Concentration | 40mg/ml |
| pH | NA |
Temperature
| 22°C |
| Incubation Period | 24-48hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Fibrillar aggregates |
| Size of Self-Assembled structure | Thickness: ~ 50nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)CO |
