| Primary information |
|---|
| SAPdb_ID | 1131 |
| PMID | 25515887 |
| Year | 2014 |
| Name | KYF |
| Sequence | KYF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), DLS (Dynamic Light Scattering) and FTIR (Fourier Transform Infrared) |
| Solvent | water |
| Method | Tripeptide was dissolved in water by sonication and vortexing, followed by bringing the pH to 7.2 ± 0.1 by dropwise addition of 0.25 M NaOH solution to a final concentration of 30 mmol. Characterization of the resulting samples took place at least 24 h after sample preparation |
| Concentration | 30mMol/L |
| pH | pH 7 |
Temperature
| 25°C |
| Incubation Period | 24 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Hydrogel |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
