Details of SAPdb ID 1155 |
Primary information | ||
---|---|---|
SAPdb_ID | 1155 | |
PMID | 26631316 | |
Year | 2015 | |
Name | W1b (Linear Tri-Trp) | |
Sequence | WWW | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) | |
Solvent | Methanol:chloroform (1:1) | |
Method | NA | |
Concentration | 2.54mM | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Spherical structure | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C=O |