| Primary information |
|---|
| SAPdb_ID | 1158 |
| PMID | 12095997 |
| Year | 2002 |
| Name | hCT(15-17) |
| Sequence | DFN |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | Electron Microscopy |
| Solvent | 0.02M NaCl + 0.01M Tris |
| Method | Stock solutions (100 mg/ml) of the peptide fragments were suspended in 0.02 M NaCl, 0.01 M Tris, pH 7.2, aged for 2 days |
| Concentration | NA |
| pH | pH 7.2 |
Temperature
| NA |
| Incubation Period | 48 hours |
| Self-Assembly Formation | No |
| Type of Self-Assembly | No self-assembly |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)N)C=O |
