| Primary information |
|---|
| SAPdb_ID | 1159 |
| PMID | 21205900 |
| Year | 2011 |
| Name | Ac-IID |
| Sequence | IID |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. |
| Concentration | 10 - 20mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Hydrogel consists of fibrillar structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable under physiological conditions |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(=O)O)C=O |
