| Primary information |
|---|
| SAPdb_ID | 1165 |
| PMID | 22016623 |
| Year | 2011 |
| Name | Ac-IW3 |
| Sequence | IVW |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. |
| Concentration | 5mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | 72 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Unstable Hyrogel or small aggregate structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Unstable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C=O |
