| Primary information |
|---|
| SAPdb_ID | 1179 |
| PMID | 19527662 |
| Year | 2009 |
| Name | Triphenylalanine |
| Sequence | FFF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 3 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and FTIR (Fourier Transform Infrared) |
| Solvent | Chlorinated alcohol |
| Method | Peptide stock solution prepared in HFP (1,1,1,3,3,3-hexafluoro-2-propanol) at conc 100mg/ml. Peptide stock solution diluted with water to 2mg/ml. |
| Concentration | 2mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Plate like Nano-structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
