| Primary information |
|---|
| SAPdb_ID | 1226 |
| PMID | 25384556 |
| Year | 2015 |
| Name | Compound A |
| Sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | Camptothecin (CPT) -conjugated |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Phosphate buffer saline |
| Method | Samples were prepared by dissolving CPT–dipeptides in PBS (10 mm), then diluting to 1 mm after 24 h. |
| Concentration | 1mM |
| pH | 7.4 |
Temperature
| 37°C |
| Incubation Period | 72 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Coiled ribbon and tapes |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N |
