| Primary information |
|---|
| SAPdb_ID | 1233 |
| PMID | 25198430 |
| Year | 2014 |
| Name | FF |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Methanol + HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) |
| Method | Diphenylalanine (FF) first dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 100 mg/mL. The corresponding stock solution was then diluted to a final concentration of 1 mg/mL in methanol. |
| Concentration | 1mg/ml |
| pH | NA |
Temperature
| ~64.7°C |
| Incubation Period | 3 - 20 minutes |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Microsphere with microtube |
| Size of Self-Assembled structure | Diameter of microsphere :5–10 μm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | Artificial supersaturation caused by Joule heating effect using voltage 100V |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
