Details of SAPdb ID 1238 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1238 | |
| PMID | 20695592 | |
| Year | 2010 | |
| Name | Dipeptide 4 | |
| Sequence | AV | |
| N-Terminal Modification | Napthalene | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Conjugate | |
| Conjugate Partner | Napthalene | |
| Technique | TEM (Transmission Electron Microscopy) | |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) | |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. | |
| Concentration | 0.5 wt% | |
| pH | 3.4 +/- 0.2. | |
| Temperature | Room temperature | |
| Incubation Period | 24 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Transparent Gel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C(C)C)CO | |