| Primary information |
|---|
| SAPdb_ID | 1260 |
| PMID | 19496552 |
| Year | 2009 |
| Name | 2 Nal dipeptide or dinapthylalanine |
| Sequence | nal-nal |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | nal=D-2-napthylalanine |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | AFM (Atomic Force Microscopy |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP)/water |
| Method | Peptide was dissolved in HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) at 100mg/ml conc., solution is further diluted with water at pH 6 to make final concenteration 2mg/ml. Peptide solutions were placed onto freshly cleaved mica substrates and and dried under nitrogen gas. |
| Concentration | 2mg/ml |
| pH | 6 |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotube |
| Size of Self-Assembled structure | width 15nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable at 120°C |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](Cc1ccc2c(c1)cccc2)C=O |
