| Primary information |
|---|
| SAPdb_ID | 1262 |
| PMID | 19852501 |
| Year | 2009 |
| Name | B or AcK(NDI)K-NH2 |
| Sequence | KK |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Amidation |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. |
| Concentration | 250 μM |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | > 2 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Flattened, twisted Nanoribbons |
| Size of Self-Assembled structure | Width 20-70 nm and height 16nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N |
