Details of SAPdb ID 1262 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1262 | |
| PMID | 19852501 | |
| Year | 2009 | |
| Name | B or AcK(NDI)K-NH2 | |
| Sequence | KK | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Conjugate | |
| Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide | |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) | |
| Solvent | Water | |
| Method | Peptide dissolved in water. 10 ul of peptide solution at conc 250 μM incubated atleast for 2 hours at mica surface. | |
| Concentration | 250 μM | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | > 2 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Flattened, twisted Nanoribbons | |
| Size of Self-Assembled structure | Width 20-70 nm and height 16nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N | |