Details of SAPdb ID 1333 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1333 | |
| PMID | 23706149 | |
| Year | 2013 | |
| Name | Phe-Phe | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | SEM (Scanning Electron Microscopy) | |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol)+Chloroform | |
| Method | 0.40 M stock Phe−Phe solution was first prepared in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) and then diluted by AuNPs containing chloroform (3.0 × 1010 to 5.6 × 1011 particles/mL) to give a final concentration of 8.0 mM. allow to keep at room temperature. | |
| Concentration | 8mM | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Organogel (Small fibres with varying length)) | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | In presence of gold nanoparticles | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |