Details of SAPdb ID 1351 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1351 | |
| PMID | 23915244 | |
| Year | 2013 | |
| Name | D-Ala-D-Ala | |
| Sequence | aa | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) | |
| Solvent | Tetrahydrofuran (THF) | |
| Method | Peptide dissolved in solvent at final conc. 30mg/ml by heating at 40 °C. Self assembled structure formed at room temperature. | |
| Concentration | 30mg/ml | |
| pH | NA | |
| Temperature | 25°C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Left handed Nanoribbon | |
| Size of Self-Assembled structure | Width : 50-200nm; thickness: 20-30nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@H](C)C(=O)N[C@H](C)C=O | |