Details of SAPdb ID 1355 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1355 | |
| PMID | 24036697 | |
| Year | 2013 | |
| Name | CDP or H–Phe–Phe–NH2. HCl | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | Co-assemble with azobenzed molecule i.e. CPABS (4-[(3-carboxyl-4-hydroxy)phenylazo]benzenesulfonic acid) | |
| Technique | SEM (Scanning Electron Microscopy) | |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water | |
| Method | Peptide added to water and to dissolve peptide in solutioh 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) added. Upon adding aqueous solutions of azobenzenes i.e . CPABS to HFIP solution of CDP (in a 1 : 1 mole ratio) at room temperature, yellow precipitates formed rapidly, indicating generation of co-assembled nanostructures. | |
| Concentration | NA | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | Several hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Microsphere | |
| Size of Self-Assembled structure | Diameter: 25μm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | Coassembly with Azobenzene | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N | |