Details of SAPdb ID 1403 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1403 | |
| PMID | 24999600 | |
| Year | 2014 | |
| Name | YF dipeptide | |
| Sequence | YF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | SEM (Scanning Electron Microscopy) and TEM (Transmission Electron Microscopy) | |
| Solvent | TFE (2,2,2-trifluoroethanol) | |
| Method | Dipeptide was dissolved in TEF at 1 mg ml−1 (stock) at 27 °C. For complete dissolution of dipeptide, solution was kept at 60 °C The sample solution was then sonicated for 20 seconds. Sample self assemble with time. | |
| Concentration | 1 mg/ml | |
| pH | NA | |
| Temperature | 27 °C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Microsphere | |
| Size of Self-Assembled structure | Diameter : 0.7 - 4.5 μm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |