| Primary information |
|---|
| SAPdb_ID | 1406 |
| PMID | 25377526 |
| Year | 2014 |
| Name | Di- lysine or KK |
| Sequence | KK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Mixture |
| Conjugate Partner | H2TPPS[tetrakis(4-sulfonatophenyl)porphine] |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water + Tetraphenylporphyrin |
| Method | Aqueous solution of H2TPPS (1 mM), HCl solution (1 M) and KK solution (0.1 M) mixed. The final concentration of H2TPPS and KK is 0.1 and 1 mM, respectively,and thel pH of final solution is 1.9. |
| Concentration | 0.1M |
| pH | pH 1.9 or < 2.0 |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Fibril bundles |
| Size of Self-Assembled structure | Width and length : in micrometers |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Photostable |
| Comment | Co-assembly with H2TPPS[tetrakis(4-sulfonatophenyl)porphine] |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O |
