Welcome to Entry Card of Peptide
Details of SAPdb ID 1407 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1407 | |
| PMID | 25229206 | |
| Year | 2014 | |
| Name | NDI-Phe-Phe or 1 | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Mixture | |
| Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide | |
| Technique | TEM (Transmission Electron Microscopy) | |
| Solvent | Water | |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. | |
| Concentration | 2% wt | |
| pH | pH 4.8 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |