| Primary information |
|---|
| SAPdb_ID | 1412 |
| PMID | 25229206 |
| Year | 2014 |
| Name | NDI-Phe-Gly or 2 |
| Sequence | FG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Mixture |
| Conjugate Partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Concentration | 2% wt |
| pH | pH 7.4 |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Transparent Hydrogel |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC=O |
