Details of SAPdb ID 1419 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1419 | |
| PMID | 26086903 | |
| Year | 2015 | |
| Name | Val-Ala | |
| Sequence | VA | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | SEM (Scanning Electron Microscopy) | |
| Solvent | 2- propanol | |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. | |
| Concentration | 2mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Wire like structures | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O | |