| Primary information |
|---|
| SAPdb_ID | 1422 |
| PMID | 26086903 |
| Year | 2015 |
| Name | Val-Ala |
| Sequence | VA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Pyrimidine |
| Method | Dipeptide dissolved in solvent at conc 2mg/ml at 50 °C for 5 min and cooled to room temperature. This solution was then placed on cleaned silicon wafers orglass slides and dried until the solvent evaporated. |
| Concentration | 1mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Rectangular plate-like |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](C(C)C)C(=O)N[C@@H](C)C=O |
