| Primary information |
|---|
| SAPdb_ID | 1451 |
| PMID | 24301009 |
| Year | 2013 |
| Name | NH2-Phe-Phe-OH |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water |
| Method | Peptide dissolved in HFP at conc 100mg/ml and solution is vortexed. Finally solution is diluted with water at final conc 2mg/ml. Solution is kept at room temperature for 24 hours. |
| Concentration | 2mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | 24 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotube |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
