Details of SAPdb ID 1451 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1451 | |
| PMID | 24301009 | |
| Year | 2013 | |
| Name | NH2-Phe-Phe-OH | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and AFM (Atomic Force Microscopy) | |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water | |
| Method | Peptide dissolved in HFP at conc 100mg/ml and solution is vortexed. Finally solution is diluted with water at final conc 2mg/ml. Solution is kept at room temperature for 24 hours. | |
| Concentration | 2mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 24 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotube | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |