| Primary information |
|---|
| SAPdb_ID | 1455 |
| PMID | 24422499 |
| Year | 2014 |
| Name | Diphenylalanine |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Formamide solution |
| Method | Peptide supersaturated solution placed on a glass slide and solutions in various solvents were placed on a glass slide and were left to dry at room temperature. |
| Concentration | 2.6 x 10 -4 M |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | 24 - 48 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Translucent gel |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
