| Primary information |
|---|
| SAPdb_ID | 1482 |
| PMID | 22651803 |
| Year | 2012 |
| Name | Dipeptide11 |
| Sequence | AA |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | NA |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Concentration | 5mg/ml or 0.5%wt |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | 24 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Transparent or clear gel |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O |
