Details of SAPdb ID 1482 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1482 | |
| PMID | 22651803 | |
| Year | 2012 | |
| Name | Dipeptide11 | |
| Sequence | AA | |
| N-Terminal Modification | Napthalene | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | NA | |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction | |
| Solvent | Water + 0.1 M NaOH | |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. | |
| Concentration | 5mg/ml or 0.5%wt | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 24 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Transparent or clear gel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc2c(c1)cccc2)C(=O)N[C@@H](C)C=O | |